12650-71-4 Usage
Description
4-O-[4-O-(α-D-Glucopyranosyl)-β-D-glucopyranosyl]-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-1,5,6-trideoxy-D-chiro-inositol is a complex carbohydrate derivative with a unique structure that features multiple hydroxyl groups and a cyclohexenyl moiety. 4-O-[4-O-(α-D-Glucopyranosyl)-β-D-glucopyranosyl]-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-1,5,6-trideoxy-D-chiro-inositol is characterized by its ability to form hydrogen bonds and interact with various biological molecules, making it a potential candidate for pharmaceutical and industrial applications.
Uses
Used in Pharmaceutical Applications:
4-O-[4-O-(α-D-Glucopyranosyl)-β-D-glucopyranosyl]-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-1,5,6-trideoxy-D-chiro-inositol is used as a therapeutic agent for targeting specific biological pathways. Its unique structure allows it to interact with various receptors and enzymes, potentially leading to the development of new drugs for the treatment of various diseases.
Used in Drug Delivery Systems:
In the field of drug delivery, 4-O-[4-O-(α-D-Glucopyranosyl)-β-D-glucopyranosyl]-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-1,5,6-trideoxy-D-chiro-inositol can be employed as a carrier molecule for the targeted delivery of drugs. Its ability to form hydrogen bonds and interact with biological molecules can be utilized to improve the bioavailability and efficacy of drugs, particularly in cancer therapy.
Used in Agricultural Applications:
4-O-[4-O-(α-D-Glucopyranosyl)-β-D-glucopyranosyl]-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-1,5,6-trideoxy-D-chiro-inositol is used as an antibiotic agent and a potential fungicide in the treatment of sheathe blight of rice. Its complex structure and ability to interact with biological molecules make it a promising candidate for the development of new agrochemicals to combat plant diseases.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-O-[4-O-(α-D-Glucopyranosyl)-β-D-glucopyranosyl]-5-(hydroxymethyl)-1-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-1,5,6-trideoxy-D-chiro-inositol can serve as a key intermediate for the synthesis of various complex carbohydrates and glycoconjugates. Its unique structure and functional groups can be exploited to develop new synthetic routes and methodologies for the preparation of biologically active compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 12650-71-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,6,5 and 0 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 12650-71:
(7*1)+(6*2)+(5*6)+(4*5)+(3*0)+(2*7)+(1*1)=84
84 % 10 = 4
So 12650-71-4 is a valid CAS Registry Number.
InChI:InChI=1/C26H45NO18/c28-3-7-1-9(14(33)17(36)13(7)32)27-10-2-8(4-29)23(19(38)15(10)34)44-26-22(41)20(39)24(12(6-31)43-26)45-25-21(40)18(37)16(35)11(5-30)42-25/h1,8-41H,2-6H2
12650-71-4Relevant articles and documents
Synthetic studies on antibiotic validamycins. Part 13. Total synthesis of (+)-validamycins A and E, and related compounds
Miyamoto, Yasunobu,Ogawa, Seiichiro
, p. 1013 - 1018 (2007/10/02)
(+)-Validoxylamine A (1) has been completely synthesized by deoxygenation of the validoxylamine B derivative (6) through formation of the aziridine, nucleophilic displacement with toluenethiol, reduction with Raney nickel, and deprotection. The validoxylamine A derivative (10) obtained was convertible, by glycosylation followed by deprotection, into validamycins A (2), E (3), and their analogues, which constitutes a total synthesis thereof.