126768-94-3 Usage
General Description
H-GLN-LYS-ARG-PRO-SER-GLN-ARG-SER-LYS-TYR-LEU-OH is a peptide composed of the amino acids glutamine (GLN), lysine (LYS), arginine (ARG), proline (PRO), serine (SER), and tyrosine (TYR), as well as the C-terminal leucine (LEU). This sequence of amino acids has the potential to exhibit biological activity, with each amino acid contributing its own unique properties to the overall structure and function of the peptide. This peptide may have implications in various biochemical processes and biological pathways, and could potentially be used in pharmaceutical or research applications for its specific sequence and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 126768-94-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,7,6 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 126768-94:
(8*1)+(7*2)+(6*6)+(5*7)+(4*6)+(3*8)+(2*9)+(1*4)=163
163 % 10 = 3
So 126768-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C60H103N21O17/c1-32(2)28-42(58(97)98)78-53(92)41(29-33-15-17-34(84)18-16-33)77-50(89)37(11-4-6-24-62)74-54(93)43(30-82)79-51(90)38(12-7-25-70-59(66)67)73-52(91)39(20-22-47(65)86)75-55(94)44(31-83)80-56(95)45-14-9-27-81(45)57(96)40(13-8-26-71-60(68)69)76-49(88)36(10-3-5-23-61)72-48(87)35(63)19-21-46(64)85/h15-18,32,35-45,82-84H,3-14,19-31,61-63H2,1-2H3,(H2,64,85)(H2,65,86)(H,72,87)(H,73,91)(H,74,93)(H,75,94)(H,76,88)(H,77,89)(H,78,92)(H,79,90)(H,80,95)(H,97,98)(H4,66,67,70)(H4,68,69,71)