126926-38-3 Usage
Description
Methyl 3-(diethylcarbamoyl)benzoate, also known as 3-[(diethylamino)carbonyl]benzoic acid methyl ester, is an organic compound that serves as a key intermediate in the synthesis of various chemical compounds. It is characterized by the presence of a carbamoyl group attached to a benzene ring, with a methyl ester group at the 3-position. This unique structure endows it with versatile chemical properties, making it a valuable component in the development of pharmaceuticals and other chemical products.
Uses
Used in Pharmaceutical Industry:
Methyl 3-(diethylcarbamoyl)benzoate is used as a synthetic intermediate for the preparation of internal standards in the determination of carboxylic acid metabolites of N,N-diethyl-m-toluamide compounds in rat urine. This application is crucial for the accurate quantification and analysis of these metabolites, which can provide valuable insights into the pharmacokinetics and toxicology of the parent compound.
In the development of pharmaceuticals, Methyl 3-(diethylcarbamoyl)benzoate can be used as a building block for the synthesis of various drug candidates. Its unique structure allows for the formation of diverse chemical entities with potential therapeutic applications. For instance, it can be incorporated into the design of novel compounds targeting specific biological receptors or enzymes, leading to the discovery of new drugs with improved efficacy and safety profiles.
Furthermore, Methyl 3-(diethylcarbamoyl)benzoate can also be utilized in the synthesis of agrochemicals, dyes, and other specialty chemicals. Its versatility in chemical reactions and compatibility with various functional groups make it a valuable asset in the development of new products with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 126926-38-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,9,2 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 126926-38:
(8*1)+(7*2)+(6*6)+(5*9)+(4*2)+(3*6)+(2*3)+(1*8)=143
143 % 10 = 3
So 126926-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO3/c1-4-14(5-2)12(15)10-7-6-8-11(9-10)13(16)17-3/h6-9H,4-5H2,1-3H3
