127168-93-8 Usage
Description
METHYL ISOINDOLINE-5-CARBOXYLATE HYDROCHLORIDE, with the CAS number 127168-93-8, is a chemical compound that serves as a crucial reagent in the synthesis of azabicyclooctane derivatives. These derivatives are known to act as FXR inhibitors, which play a significant role in various biological processes and therapeutic applications.
Uses
Used in Pharmaceutical Industry:
METHYL ISOINDOLINE-5-CARBOXYLATE HYDROCHLORIDE is used as a reagent for the preparation of azabicyclooctane derivatives, which are essential in the development of FXR inhibitors. These inhibitors have potential applications in the treatment of various diseases and conditions, such as liver disorders and metabolic syndromes, by modulating the activity of the farnesoid X receptor (FXR).
Used in Chemical Synthesis:
In the field of chemical synthesis, METHYL ISOINDOLINE-5-CARBOXYLATE HYDROCHLORIDE is utilized as a key intermediate in the production of various compounds, including pharmaceuticals and other specialty chemicals. Its unique chemical structure allows for the creation of a wide range of molecules with diverse applications, making it a valuable asset in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 127168-93-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,1,6 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 127168-93:
(8*1)+(7*2)+(6*7)+(5*1)+(4*6)+(3*8)+(2*9)+(1*3)=138
138 % 10 = 8
So 127168-93-8 is a valid CAS Registry Number.
InChI:InChI=1S/C10H11NO2.ClH/c1-13-10(12)7-2-3-8-5-11-6-9(8)4-7;/h2-4,11H,5-6H2,1H3;1H