128-76-7 Usage
Description
Laurotetanine is a noraporphine alkaloid that was first isolated from Litsea chrysocorna and other species of Lauraceae, including L. citrata and L. cubeba. It is a phenolic base that forms colorless crystals when freshly crystallized from Me2CO, which turn yellow when exposed to air. Laurotetanine contains three methoxyl groups, an imino group, and a phenolic hydroxyl group, which can be methylated to form an amorphous powder. The structure of laurotetanine has been determined through chemical degradation and synthesis.
Uses
1. Used in Pharmaceutical Applications:
Laurotetanine is used as a pharmaceutical compound due to its phenolic base nature and the presence of various functional groups. Its ability to form salts with mineral acids and its reactivity with other compounds make it a promising candidate for the development of new drugs and therapies.
2. Used in Chemical Synthesis:
Laurotetanine can be used as a starting material or intermediate in the synthesis of various organic compounds, particularly those with potential applications in the pharmaceutical, agrochemical, or materials science industries. Its unique structure and functional groups allow for a wide range of synthetic modifications and the creation of novel molecules with diverse properties.
3. Used in Research and Development:
As a naturally occurring alkaloid with a complex structure, laurotetanine can be utilized in research and development efforts to better understand the properties and potential applications of noraporphine alkaloids. This knowledge can be applied to the discovery of new bioactive compounds, the development of novel drug delivery systems, and the improvement of existing pharmaceuticals.
4. Used in Analytical Chemistry:
The unique properties of laurotetanine, such as its phenolic hydroxyl group and its ability to form salts with mineral acids, make it a valuable compound for use in analytical chemistry. It can be employed as a reference material, a standard for calibration, or a reagent in various analytical techniques, such as chromatography, spectroscopy, or titration.
5. Used in Natural Product Chemistry:
Laurotetanine's isolation from various species of Lauraceae highlights its importance in the field of natural product chemistry. It can be used to study the biosynthesis, distribution, and ecological roles of noraporphine alkaloids in plants. Additionally, laurotetanine can serve as a model compound for the investigation of the chemical diversity and biological activities of natural products derived from Lauraceae and other plant families.
References
Greshoff., Ber., 23,3537 (1890)
Filippo., Arch. Pharm., 236, 601 (1898)
Gorter., Bull. Jard. bot. Buitenzorg., 3, 180 (1921)
Barger, Silberschmidt.,J. Chem. Soc., 2919 (1928)
Barger et al., Ber., 66, 450 (1933)
Ruegger., Helv. Chim. Acta, 42,754 (1959)
Kikkawa.,J. Pharm. Soc., Japan, 79,83,425 (1959)
Check Digit Verification of cas no
The CAS Registry Mumber 128-76-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 128-76:
(5*1)+(4*2)+(3*8)+(2*7)+(1*6)=57
57 % 10 = 7
So 128-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H21NO4/c1-22-15-9-12-11(7-14(15)21)6-13-17-10(4-5-20-13)8-16(23-2)19(24-3)18(12)17/h7-9,13,20-21H,4-6H2,1-3H3