128942-39-2 Usage
Description
7-FLUORO-4-OXO-4H-CHROMENE-2-CARBOXYLIC ACID is a chemical compound that serves as a key reactant in the synthesis of various pharmaceutical agents. It is characterized by its unique structure, which includes a fluorinated chromone core and a carboxylic acid functional group. 7-FLUORO-4-OXO-4H-CHROMENE-2-CARBOXYLIC ACID plays a crucial role in the development of novel therapeutic agents, particularly in the field of medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
7-FLUORO-4-OXO-4H-CHROMENE-2-CARBOXYLIC ACID is used as a reactant for the preparation of fluorocarboxychromone aminopiperidine-based melanin-concentrating hormone receptor 1 (MCHR1) antagonists. These antagonists are of significant interest in the pharmaceutical industry due to their potential applications in the treatment of various disorders, such as obesity and related metabolic diseases.
The synthesis of these MCHR1 antagonists involves the use of 7-FLUORO-4-OXO-4H-CHROMENE-2-CARBOXYLIC ACID as a key building block, which allows for the creation of diverse and structurally unique compounds with potential therapeutic properties. By incorporating this compound into the molecular framework of MCHR1 antagonists, researchers can explore new avenues for the development of more effective and targeted treatments for obesity and other related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 128942-39-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,9,4 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 128942-39:
(8*1)+(7*2)+(6*8)+(5*9)+(4*4)+(3*2)+(2*3)+(1*9)=152
152 % 10 = 2
So 128942-39-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H5FO4/c11-5-1-2-6-7(12)4-9(10(13)14)15-8(6)3-5/h1-4H,(H,13,14)
128942-39-2Relevant articles and documents
Antagonists of melanin concentrating hormone effects on the melanin concentrating hormone receptor
-
Page/Page column 41, (2010/02/14)
The present invention is directed to compounds of formula (I), which antagonize of the effects of melanin-concentrating hormone (MCH) through the melanin concentrating hormone receptor which is useful for the prevention or treatment of eating disorders, weight gain, obesity, abnormalities in reproduction and sexual behavior, thyroid hormone secretion, diuresis and water/electrolyte homeostasis, sensory processing, memory, sleeping, arousal, anxiety, depression, seizures, neurodegeneration and psychiatric disorders.
