129365-02-2 Usage
Description
N(3)-(iodoacetyl)-2,3-diaminopropanoic acid is a chemical compound with the molecular formula C5H10IN3O2. It is a derivative of the amino acid cysteine, containing a modified side chain with an iodoacetyl group. N(3)-(iodoacetyl)-2,3-diaminopropanoic acid is known for its reactivity towards sulfhydryl groups, which makes it a valuable tool in various biochemical and pharmaceutical applications.
Uses
Used in Bioconjugation and Crosslinking Reactions:
N(3)-(iodoacetyl)-2,3-diaminopropanoic acid is used as a reagent in bioconjugation and crosslinking reactions for the labeling and modification of proteins and peptides. Its specific reactivity with sulfhydryl groups allows for targeted and efficient conjugation, making it a preferred choice in biochemical research.
Used in Protein Chemistry:
In the field of protein chemistry, N(3)-(iodoacetyl)-2,3-diaminopropanoic acid serves as a crucial component for studying protein structure and function. Its ability to form covalent bonds with proteins enables researchers to probe and manipulate protein interactions and properties.
Used in Drug Development:
N(3)-(iodoacetyl)-2,3-diaminopropanoic acid is utilized in drug development for the design and synthesis of novel therapeutic agents. Its unique chemical properties and reactivity contribute to the creation of potential drug candidates that can modulate protein function and activity.
Used in Diagnostic Assays:
In diagnostic assays, N(3)-(iodoacetyl)-2,3-diaminopropanoic acid is employed as a key component for the detection and quantification of specific proteins and peptides. Its reactivity with sulfhydryl groups allows for the development of sensitive and specific assays for various diagnostic applications.
Overall, N(3)-(iodoacetyl)-2,3-diaminopropanoic acid is a versatile and important tool in the fields of biochemistry, pharmaceutical research, and diagnostics, owing to its unique chemical properties and reactivity with biological molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 129365-02-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,3,6 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 129365-02:
(8*1)+(7*2)+(6*9)+(5*3)+(4*6)+(3*5)+(2*0)+(1*2)=132
132 % 10 = 2
So 129365-02-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H9IN2O3/c6-1-4(9)8-2-3(7)5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)/t3-/m1/s1