129639-79-8 Usage
Description
N-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]-1,4,5,6-tetrahydropyrimidin-2-amine is a compound belonging to the class of guanidines. It is characterized by a tetrahydropyrimidin-2(1H)-imine structure, where the hydrogen of the imino group is replaced by a thiazol-2-yl group. This thiazol-2-yl group is further substituted by a 2-(2,4-dimethylphenoxy)phenyl group at position 4. This unique molecular structure endows it with potential applications in various fields.
Uses
1. Used in Antifungal Applications:
N-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]-1,4,5,6-tetrahydropyrimidin-2-amine is used as a broad-spectrum antifungal agent for the topical treatment of fungal nail infections. Its efficacy in targeting and treating fungal infections makes it a valuable compound in the field of dermatology and antifungal therapy.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, N-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]-1,4,5,6-tetrahydropyrimidin-2-amine is used as a key intermediate in the synthesis of various therapeutic agents. Its unique chemical structure allows for the development of new drugs with potential applications in treating a wide range of diseases and conditions.
3. Used in Research and Development:
N-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]-1,4,5,6-tetrahydropyrimidin-2-amine is also utilized in research and development settings, where it serves as a valuable tool for understanding the mechanisms of action and potential interactions of various biological targets. Its use in research can lead to the discovery of new therapeutic strategies and the development of novel drugs with improved efficacy and safety profiles.
Originator
Abafungin,York Pharma
Manufacturing Process
15.8 g (0.12 mole) N-(1,4,5,6-tetrahydropyrimidinyl)thiourea were added to
27.45 g (0.1 mole) 2-(2,4-dimethylphenoxy)phenacyl chloride in 100 ml
acetone and heated to reflux for 2 hours. On cooling the falling out product
was filtered off, washed with acetone and dried. N-[4-[2-(2,4-
Dimethylphenoxy)phenyl]-2-thiazolyl]-1,4,5,6-tetrahydro-2-pyrimidinamine
hydrochloride was prepared. Yield 91.4%; MP: 160°C.
20.72 g (0.05 mole) above product was stirred with 300 ml 1 N sodium
hydroxide for 30 minutes at room temperature. The insoluble product was
filtered off, washed and dried. Yield of N-[4-[2-(2,4-dimethylphenoxy)phenyl]-
2-thiazolyl]-1,4,5,6-tetrahydro-2-pyrimidinamine was 16.2 g (86%). MP:
191°-192°C.
Therapeutic Function
Antibacterial, Antifungal
Check Digit Verification of cas no
The CAS Registry Mumber 129639-79-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,3 and 9 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 129639-79:
(8*1)+(7*2)+(6*9)+(5*6)+(4*3)+(3*9)+(2*7)+(1*9)=168
168 % 10 = 8
So 129639-79-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H22N4OS/c1-14-8-9-18(15(2)12-14)26-19-7-4-3-6-16(19)17-13-27-21(24-17)25-20-22-10-5-11-23-20/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H2,22,23,24,25)