129820-74-2 Usage
General Description
3-Acetylimidazo[1,2-a]pyridin-2(3H)-one is a chemical compound with the molecular formula C9H7N3O2. It is a heterocyclic organic compound belonging to the class of imidazole derivatives. 3-ACETYLIMIDAZO[1,2-A]PYRIDIN-2(3H)-ONE is often used in medicinal chemistry and drug development due to its potential biological activities. It has been found to exhibit anti-inflammatory, antitumor, and antiviral properties, making it a valuable candidate for the development of new pharmaceutical drugs. Its unique structure and diverse biological activities make it an important target for further research and development in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 129820-74-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,8,2 and 0 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 129820-74:
(8*1)+(7*2)+(6*9)+(5*8)+(4*2)+(3*0)+(2*7)+(1*4)=142
142 % 10 = 2
So 129820-74-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N2O2/c1-6(12)8-9(13)10-7-4-2-3-5-11(7)8/h2-5,10,13H,1H3