130137-05-2 Usage
General Description
4,5-DIFLUORO-2-IODOBENZOIC ACID is a chemical compound that belongs to the class of benzoic acids. It is a white to light yellow solid, and it is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 4,5-DIFLUORO-2-IODOBENZOIC ACID is often employed as a building block in organic synthesis for the production of various chemical compounds. It is known for its strong acidity and its ability to act as a versatile reagent in various chemical reactions. Additionally, 4,5-DIFLUORO-2-IODOBENZOIC ACID has been studied for its potential applications in the field of medicinal chemistry and drug discovery due to its unique structural properties that can influence biological activity in certain molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 130137-05-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,1,3 and 7 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 130137-05:
(8*1)+(7*3)+(6*0)+(5*1)+(4*3)+(3*7)+(2*0)+(1*5)=72
72 % 10 = 2
So 130137-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H3F2IO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,(H,11,12)