130914-24-8 Usage
Description
Chlorodicyclopentylphosphine 97, also known as ClCp, is a phosphine compound with the molecular formula C5H8ClP. It is a colorless to pale yellow liquid and is widely used as a precursor for the synthesis of various ligands in organic chemistry. Its unique structure and reactivity make it a valuable building block for the development of new catalysts and ligands in the field of homogeneous catalysis.
Uses
Used in Pharmaceutical Industry:
Chlorodicyclopentylphosphine 97 is used as a precursor for the synthesis of chiral diphosphinite ligands, such as Cp,Cp-MannOP, by reacting with mannitol. These chiral ligands are essential in the development of enantioselective catalysts, which play a crucial role in the synthesis of pharmaceutical compounds with high enantiomeric purity.
Used in Chemical Industry:
Chlorodicyclopentylphosphine 97 is used as a precursor for the synthesis of bis(dicycloalkylphosphino) amidophosphine-phosphinite ligands, such as (S)-Cp,Cp-oxoProNOP, by reacting with (S)-5-(hydroxymethyl)-2-pyrrolidinone. These ligands are employed in the development of catalysts for various chemical reactions, including the formation of carbon-carbon and carbon-heteroatom bonds.
Used in Environmental Applications:
Chlorodicyclopentylphosphine 97 is used as a precursor for the synthesis of LcPeNiCl, which is an efficient catalyst for the reduction of CO2 to valuable chemicals, such as formic acid and methanol. This application is particularly relevant in the context of climate change and the need for sustainable chemical production processes.
Used in Catalyst Development:
Chlorodicyclopentylphosphine 97 is used as a phosphine precursor in Negishi and Suzuki coupling reactions, which are essential for the formation of carbon-carbon bonds in the synthesis of complex organic molecules, including pharmaceuticals, agrochemicals, and advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 130914-24-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,9,1 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 130914-24:
(8*1)+(7*3)+(6*0)+(5*9)+(4*1)+(3*4)+(2*2)+(1*4)=98
98 % 10 = 8
So 130914-24-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H18ClP/c11-12(9-5-1-2-6-9)10-7-3-4-8-10/h9-10H,1-8H2
130914-24-8Relevant articles and documents
2,2'-bis (dicyclopentylphosphino)-1,1'-binaphthyl and transition metal complex using the same as ligand
-
, (2008/06/13)
Novel 2,2'-bis(dicyclopentylphosphino)-1,1'-binaphthyl represented by formula (I): STR1 and a transition metal complex using the same as a ligand, are disclosed. The transition metal complex is industrially excellent as a catalyst for various asymmetric synthesis reactions.
