131195-83-0 Usage
General Description
2,6-dimethyl-9-methoxy-4H-pyrrolo(3,2,1-ij)quinolin-4-one is a complex organic chemical compound with a unique fused ring system. It consists of a pyrrole ring fused with a quinoline ring, and is substituted with two methyl groups and a methoxy group at specific positions. 2,6-dimethyl-9-methoxy-4H-pyrrolo(3,2,1-ij)quinolin-4-one has potential applications in the field of medicinal chemistry and drug development due to its diverse structural features and potential biological activities. Its unique and complex structure makes it an interesting target for synthetic chemists and researchers looking to explore its potential pharmaceutical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 131195-83-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,1,9 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 131195-83:
(8*1)+(7*3)+(6*1)+(5*1)+(4*9)+(3*5)+(2*8)+(1*3)=110
110 % 10 = 0
So 131195-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO2/c1-8-6-13(16)15-9(2)7-11-12(17-3)5-4-10(8)14(11)15/h4-7H,1-3H3
131195-83-0Relevant articles and documents
New synthesis of pyrrolo[3,2,1-ij]quinolin-4-one derivatives
Chilin,Rodighiero,Pastorini,Guiotto
, p. 980 - 983 (1991)
-
REGIOSPECIFIC SYNTHESIS OF 1H,5H- AND 3H,5H-BENZOQUINOLIZIN-5-ONE DERIVATIVES
Rodighiero, Paolo,Chilin, Adriana,Bandoli, Giuliano,Manzini, Paolo,Castellin, Andrea,Guiotto, Adriano
, p. 167 - 172 (2007/10/02)
Regiospecific separate syntheses of the new 1H,5H- and 3H,5H-benzoquinolizin-5-one derivatives exploiting 2-bromo-10-hydroxy-7-methyl-1H,2H,3H,5H-benzoquinolizin-5-one as common key intermediate are described.The structure of 2-bromo-10-hydroxy-7-methyl-1H,2H,3H,5H-benzoquinolizin-5-one has been determined by X-ray analysis.Crystal data: a = 7.248(3), b = 18.40(1), c = 9.132(7) Angstroem, β = 106.08(5) deg; space group P21/c; Z = 4.
