13130-40-0 Usage
General Description
2-ACETYLAMINO-4,5-DIMETHYL-THIOPHENE-3-CARBOXYLIC ACID is a chemical compound with a molecular formula C12H15NO3S. It is a derivative of thiophene, which is a heterocyclic compound containing sulfur. 2-ACETYLAMINO-4,5-DIMETHYL-THIOPHENE-3-CARBOXYLIC ACID contains an acetyl group, an amino group, two methyl groups, and a carboxylic acid group attached to the thiophene ring. It is commonly used in the synthesis of various pharmaceuticals and agrochemicals, as well as in the production of dyes and pigments. The compound has potential applications in the field of medicinal chemistry due to its ability to interact with biological systems and exhibit various biological activities. Additionally, it has been studied for its potential anti-inflammatory and antibacterial properties.
Check Digit Verification of cas no
The CAS Registry Mumber 13130-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,3 and 0 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 13130-40:
(7*1)+(6*3)+(5*1)+(4*3)+(3*0)+(2*4)+(1*0)=50
50 % 10 = 0
So 13130-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO3S/c1-4-5(2)14-8(10-6(3)11)7(4)9(12)13/h1-3H3,(H,10,11)(H,12,13)/p-1