132152-76-2 Usage
Description
2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE is a chemical compound that serves as an intermediate in the synthesis of various pharmaceuticals and bioactive molecules. It is characterized by its white foam appearance and plays a crucial role in the development of certain inhibitors.
Uses
Used in Pharmaceutical Synthesis:
2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE is used as an intermediate in the synthesis of PugNAc (Cat. No. A15725), which is an inhibitor of glucosamidase. This application is significant in the pharmaceutical industry, as it contributes to the development of drugs targeting specific enzymes involved in various diseases.
Used in Chemical Research:
In addition to its pharmaceutical applications, 2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE may also be utilized in chemical research for the exploration of new compounds and their potential applications in various fields, including medicine, agriculture, and materials science.
Used in Enzyme Inhibition Studies:
2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE can be employed in enzyme inhibition studies to understand the interactions between the compound and specific enzymes, which can provide valuable insights into the development of novel therapeutic strategies for various diseases.
Used in the Synthesis of Bioactive Molecules:
2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE may also be used in the synthesis of other bioactive molecules with potential applications in the pharmaceutical, agricultural, and chemical industries. Its versatility as a synthetic intermediate allows for the exploration of a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 132152-76-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,1,5 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 132152-76:
(8*1)+(7*3)+(6*2)+(5*1)+(4*5)+(3*2)+(2*7)+(1*6)=92
92 % 10 = 2
So 132152-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O6/c1-3(12)9-5-7(14)6(13)4(2-11)16-8(5)10-15/h4-7,11,13-15H,2H2,1H3,(H,9,12)/t4?,5?,6-,7?/m1/s1
