132152-77-3 Usage
Description
2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE 1-N,3,4,6-TETRAACETATE is a complex organic compound that serves as an intermediate in the synthesis of various biochemical compounds. It is characterized by its white foam appearance and plays a crucial role in the development of pharmaceuticals and other related applications.
Uses
Used in Pharmaceutical Industry:
2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE 1-N,3,4,6-TETRAACETATE is used as an intermediate in the synthesis of PugNAc (Cat. No. A15725), which is an inhibitor of glucosamidase. This application is significant for the development of drugs targeting specific enzymatic pathways, potentially leading to treatments for various diseases and conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE 1-N,3,4,6-TETRAACETATE is utilized as a key component in the creation of various complex molecules. Its unique structure allows for further modification and functionalization, making it a valuable asset in the synthesis of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 132152-77-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,1,5 and 2 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 132152-77:
(8*1)+(7*3)+(6*2)+(5*1)+(4*5)+(3*2)+(2*7)+(1*7)=93
93 % 10 = 3
So 132152-77-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N2O10/c1-7(19)17-13-15(26-10(4)22)14(25-9(3)21)12(6-24-8(2)20)27-16(13)18-28-11(5)23/h12-15H,6H2,1-5H3,(H,17,19)/t12?,13-,14+,15+/m0/s1