133530-15-1 Usage
Chemical compound
18-methyl-5,9-eicosadienoic acid is a chemical compound, which means it is a substance formed from the combination of two or more elements in a fixed ratio.
Eicosanoid family
It belongs to the eicosanoid family of fatty acids, which are a group of naturally occurring compounds derived from fatty acids with various biological functions.
Long-chain polyunsaturated fatty acid
The compound has a 20-carbon chain and is classified as a long-chain polyunsaturated fatty acid due to the presence of multiple double bonds.
Double bonds at 5th and 9th positions
The two double bonds in the 20-carbon chain are located at the 5th and 9th positions, contributing to its unique structure and properties.
Methyl group at the 18th position
A methyl group (a carbon atom with three hydrogen atoms) is attached to the 18th carbon in the chain, further modifying the structure of the compound.
Anti-inflammatory properties
18-methyl-5,9-eicosadienoic acid is known for its potential anti-inflammatory properties, which means it may help reduce inflammation in the body.
Beneficial effects on inflammatory and metabolic conditions
The compound is believed to have beneficial effects on various inflammatory and metabolic conditions, such as cardiovascular disease, diabetes, and arthritis.
Found in certain fish and seafood
It is present in small amounts in specific types of fish and seafood, which can be a source of this compound in the diet.
Synthesized in the human body
The compound can be synthesized in the human body from dietary fats, meaning that the body can produce it using other fatty acids obtained from the diet.
Potential therapeutic applications
Studies have shown that 18-methyl-5,9-eicosadienoic acid may have potential therapeutic applications in treating conditions like cardiovascular disease, diabetes, and arthritis, although more research is needed to fully understand its mechanisms and health benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 133530-15-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,3,5,3 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 133530-15:
(8*1)+(7*3)+(6*3)+(5*5)+(4*3)+(3*0)+(2*1)+(1*5)=91
91 % 10 = 1
So 133530-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C21H38O2/c1-3-20(2)18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21(22)23/h4-5,11,13,20H,3,6-10,12,14-19H2,1-2H3,(H,22,23)/b5-4-,13-11-
