134318-72-2 Usage
General Description
2-Pyrimidineacetonitrile, 4-amino- (9CI) is a chemical compound with the molecular formula C6H6N4. It is a derivative of pyrimidine and contains an aminomethyl group. 2-Pyrimidineacetonitrile, 4-amino- (9CI) has potential pharmaceutical applications and is used as a building block in the synthesis of various drugs and pharmaceuticals. It has been reported to have antibacterial, antiviral, and antifungal properties, making it a potentially valuable compound for disease treatment. Additionally, 2-Pyrimidineacetonitrile, 4-amino- (9CI) is also used in the field of organic chemistry as a versatile intermediate for the synthesis of various organic compounds. Further research and studies on this compound may provide more insights into its potential applications and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 134318-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,3,1 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 134318-72:
(8*1)+(7*3)+(6*4)+(5*3)+(4*1)+(3*8)+(2*7)+(1*2)=112
112 % 10 = 2
So 134318-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-3-1-6-9-4-2-5(8)10-6/h2,4H,1H2,(H2,8,9,10)
