134717-73-0 Usage
Description
(5-(3-thienyl)tetrazol-1-yl)acetic acid is a chemical compound characterized by its molecular formula C9H8N4O2S. It is a tetrazole derivative featuring a thienyl group attached to the tetrazole ring, which endows the molecule with unique properties. (5-(3-thienyl)tetrazol-1-yl)acetic acid holds potential pharmacological properties and is considered for the development of new drugs. The combination of the tetrazole and thienyl moieties in its structure makes it a promising candidate for further exploration in medicinal chemistry and drug design.
Uses
Used in Pharmaceutical Development:
(5-(3-thienyl)tetrazol-1-yl)acetic acid is used as a chemical intermediate for the development of new drugs due to its potential pharmacological properties. The presence of the tetrazole and thienyl groups in the molecule may contribute to its therapeutic effects, making it a valuable compound for further research and development in the pharmaceutical industry.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (5-(3-thienyl)tetrazol-1-yl)acetic acid is used as a compound of interest for studying its unique characteristics and potential applications. The tetrazole and thienyl moieties in its structure may offer novel insights into drug design and the development of more effective therapeutic agents.
Used in Drug Design:
(5-(3-thienyl)tetrazol-1-yl)acetic acid is utilized as a key component in drug design, where its unique structural features can be leveraged to create innovative and effective medications. (5-(3-thienyl)tetrazol-1-yl)acetic acid's potential pharmacological properties make it a valuable asset in the ongoing quest to develop new drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 134717-73-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,7,1 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 134717-73:
(8*1)+(7*3)+(6*4)+(5*7)+(4*1)+(3*7)+(2*7)+(1*3)=130
130 % 10 = 0
So 134717-73-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O2S/c12-6(13)3-11-7(8-9-10-11)5-1-2-14-4-5/h1-2,4H,3H2,(H,12,13)
134717-73-0Relevant articles and documents
TETRAZOLEACETIC ACID DERIVATIVES AND USE FOR ALDOSE REDUCTASE INHIBITORY ACTIVITY
-
, (2008/06/13)
A tetrazoleacetic acid derivative represented by the following general formula (I): [in Formula (I), R1 represents a hydrogen atom or an alkyl group; R2 represents a hydrogen atom, an alkyl group, an aralkyl group, a halogen atom, a haloalkyl group, a hydroxyl group, an alkoxy group, an alkoxyalkyl group, an amino group, an aryl group, an alkyl or aryl thio group, an alkyl or aryl carbonylamino group, an alkyl or aryl sulfonylamino group, an alkyl or aryl aminosulfonyl group, an alkyl or aryl sulfonyl group or an alkyl or aryl sulfinyl group; and X represents -O- or -S-] except for [5-(2-thienyl)tetrazol-1-yl] acetic acid, [5-(2-furyl)tetrazol-1-yl] acetic acid and ethyl esters thereof, or a salt thereof shows excellent aldose reductase inhibitory activity, has low toxicity to organisms and is quite effective as an essential component of a preventive medicine and/or remedy for diabetic complications.
