136832-63-8 Usage
Description
5-CHLOROMETHYLFLUORESCEIN DIACETATE, also known as CMFDA, is a thio-reactive, cell-permeant fluorescent probe commonly used in various scientific applications due to its high selectivity and fluorescence properties. It is a derivative of fluorescein, a naturally occurring plant pigment, and has been modified to enhance its reactivity and detection capabilities.
Uses
Used in Cellular Imaging:
5-CHLOROMETHYLFLUORESCEIN DIACETATE is used as a fluorescent probe for cellular imaging, allowing researchers to visualize and track cellular processes in real-time. Its cell permeant property enables it to enter cells easily, while its thio-reactive nature allows it to bind to specific cellular components, providing valuable insights into cellular functions and interactions.
Used in Analytical Chemistry:
In the field of analytical chemistry, 5-CHLOROMETHYLFLUORESCEIN DIACETATE is used as a high-selectivity reagent for detecting and quantifying various analytes, such as proteins, nucleic acids, and other biomolecules. Its fluorescence properties make it an ideal tool for sensitive and accurate detection, even in complex biological samples.
Used in Environmental Monitoring:
5-CHLOROMETHYLFLUORESCEIN DIACETATE is also employed in environmental monitoring applications, where it serves as a sensitive and selective probe for detecting contaminants and pollutants in water, soil, and air samples. Its ability to bind to specific target molecules allows for the rapid and accurate identification of potential environmental hazards.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-CHLOROMETHYLFLUORESCEIN DIACETATE is used as a research tool for drug discovery and development. Its fluorescence properties enable the tracking of drug candidates within biological systems, providing valuable information on their distribution, metabolism, and potential interactions with cellular targets.
Used in Biomedical Research:
5-CHLOROMETHYLFLUORESCEIN DIACETATE is utilized in biomedical research as a versatile probe for studying various biological processes, such as cell signaling, protein-protein interactions, and gene expression. Its high selectivity and fluorescence properties make it an invaluable tool for understanding the complex mechanisms underlying various diseases and for developing targeted therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 136832-63-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,8,3 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 136832-63:
(8*1)+(7*3)+(6*6)+(5*8)+(4*3)+(3*2)+(2*6)+(1*3)=138
138 % 10 = 8
So 136832-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C25H17ClO7/c1-13(27)30-16-4-7-20-22(10-16)32-23-11-17(31-14(2)28)5-8-21(23)25(20)19-6-3-15(12-26)9-18(19)24(29)33-25/h3-11H,12H2,1-2H3