13728-56-8 Usage
Description
4-(3-phenanthryl)butanoic acid, also known as 3-Phenanthrenebutanoic Acid, is an organic compound characterized by its unique structure that features a phenanthrene group attached to a butanoic acid chain. 4-(3-phenanthryl)butanoic acid is notable for its potential role in the synthesis of complex organic molecules and its applications in various fields due to its structural properties.
Uses
Used in Chemical Synthesis:
4-(3-phenanthryl)butanoic acid is used as an intermediate in the synthesis of novel polycyclic aromatic isomers. Its unique structure allows for the creation of benz[a]anthracene derivatives with a cyclopenta-fused ring, which can have various applications in the fields of materials science, pharmaceuticals, and chemical research.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-(3-phenanthryl)butanoic acid may be utilized as a building block for the development of new drugs. Its specific structural features could be exploited to design molecules with targeted biological activities, potentially leading to the creation of novel therapeutic agents.
Used in Materials Science:
The compound's structural characteristics may also make it a candidate for use in the development of new materials with specialized properties. For instance, its incorporation into polymers or other materials could result in products with enhanced characteristics, such as improved stability or specific interactions with other molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 13728-56-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,2 and 8 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 13728-56:
(7*1)+(6*3)+(5*7)+(4*2)+(3*8)+(2*5)+(1*6)=108
108 % 10 = 8
So 13728-56-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O2/c19-18(20)7-3-4-13-8-9-15-11-10-14-5-1-2-6-16(14)17(15)12-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20)
