137394-53-7 Usage
Description
1(2H)-Pyrimidineacetic acid, 3-(3-(3,6-dihydro-3-methyl-2,6-dioxo-1(2H)-pyrimidinyl)propyl)-3,4-dihydro-2,4-dioxo-, methyl ester is a complex organic compound derived from pyrimidine, a heterocyclic compound with nitrogen atoms in its ring structure. This specific compound features a methyl ester group, which is a functional group consisting of a carbonyl group attached to an oxygen atom and a methyl group. Additionally, it contains other functional groups such as carboxylic acid and ketone groups. The presence of these functional groups suggests potential pharmaceutical or biological activity, making it a subject of interest in medicinal chemistry research.
Uses
Used in Pharmaceutical Industry:
1(2H)-Pyrimidineacetic acid, 3-(3-(3,6-dihydro-3-methyl-2,6-dioxo-1(2H)-pyrimidinyl)propyl)-3,4-dihydro-2,4-dioxo-, methyl ester is used as a potential pharmaceutical candidate for various applications due to its unique structure and the presence of multiple functional groups. These groups may allow the compound to interact with biological targets, making it a promising molecule for the development of new drugs.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1(2H)-Pyrimidineacetic acid, 3-(3-(3,6-dihydro-3-methyl-2,6-dioxo-1(2H)-pyrimidinyl)propyl)-3,4-dihydro-2,4-dioxo-, methyl ester is used as a subject of interest for studying its potential biological activity and possible applications in drug development. 1(2H)-Pyrimidineacetic acid, 3-(3-(3,6-dihydro-3-methyl-2,6-dioxo-1(2H )-pyrimidinyl)propyl)-3,4-dihydro-2,4-dioxo-, methyl ester's structure and functional groups may provide insights into new mechanisms of action or novel drug targets.
Check Digit Verification of cas no
The CAS Registry Mumber 137394-53-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,3,9 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 137394-53:
(8*1)+(7*3)+(6*7)+(5*3)+(4*9)+(3*4)+(2*5)+(1*3)=147
147 % 10 = 7
So 137394-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N4O6/c1-16-8-4-11(20)18(14(16)23)6-3-7-19-12(21)5-9-17(15(19)24)10-13(22)25-2/h4-5,8-9H,3,6-7,10H2,1-2H3