137397-56-9 Usage
Description
(7-ethenyl-12-(1-hydroxy-5,9,13-trimethyl-4,8,12-tetradecatrienyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24)-Ferrate(2-) is a complex organic molecule characterized by a porphyrin structure with a central iron atom in the +2 oxidation state. This molecule features a tetrapyrrole ring system, two propionate groups attached to the porphyrin core, a hydroxy group, and a long isoprenoid side chain. The unique structure and properties of this compound suggest potential applications in various fields, including medicine, catalysis, and materials science.
Uses
Used in Pharmaceutical Applications:
(7-ethenyl-12-(1-hydroxy-5,9,13-trimethyl-4,8,12-tetradecatrienyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24)-Ferrate(2-) is used as a pharmaceutical agent for its potential therapeutic effects. The complex structure, including the porphyrin ring and the ferrate ion, may contribute to its interaction with biological systems, making it a candidate for the development of new drugs.
Used in Catalyst Applications:
In the field of catalysis, (7-ethenyl-12-(1-hydroxy-5,9,13-trimethyl-4,8,12-tetradecatrienyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24)-Ferrate(2-) is used as a catalyst due to the presence of the iron atom, which is known to facilitate various chemical reactions. The specific structure of this molecule may enable it to act as a highly selective and efficient catalyst in certain reactions.
Used in Materials Science Applications:
(7-ethenyl-12-(1-hydroxy-5,9,13-trimethyl-4,8,12-tetradecatrienyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24)-Ferrate(2-) is used in materials science for the development of novel materials with unique properties. The porphyrin structure and the presence of the ferrate ion may endow this compound with specific optical, electronic, or magnetic properties, making it suitable for the creation of advanced materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 137397-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,3,9 and 7 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 137397-56:
(8*1)+(7*3)+(6*7)+(5*3)+(4*9)+(3*7)+(2*5)+(1*6)=159
159 % 10 = 9
So 137397-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C49H60N4O5.Fe/c1-10-35-31(6)40-26-45-49(46(54)19-13-18-30(5)17-12-16-29(4)15-11-14-28(2)3)34(9)41(53-45)24-38-32(7)36(20-22-47(55)56)43(51-38)27-44-37(21-23-48(57)58)33(8)39(52-44)25-42(35)50-40;/h10,14,16,18,24-27,46,54H,1,11-13,15,17,19-23H2,2-9H3,(H4,50,51,52,53,55,56,57,58);/q;+2/p-2/b29-16+,30-18+,38-24-,39-25-,40-26-,41-24-,42-25-,43-27-,44-27-,45-26-;