13822-63-4 Usage
Description
[[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl](methoxymethyl)amino]methanol is a complex organic molecule characterized by its unique structure and functional groups. It features a 1,3,5-triazine core with multiple methoxymethylamino groups attached, along with a methanol moiety that provides hydroxyl and methoxy functionality. This versatile compound may hold potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its distinct structural and functional attributes.
Uses
Used in Pharmaceutical Industry:
[[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl](methoxymethyl)amino]methanol is used as a potential active pharmaceutical ingredient for the development of new drugs. Its unique structure and functional groups may allow for the creation of novel therapeutic agents with specific targeting and activity profiles.
Used in Agrochemical Industry:
In the agrochemical industry, [[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl](methoxymethyl)amino]methanol may be utilized as a building block or intermediate in the synthesis of new pesticides or other agrochemical products. Its versatile functional groups could contribute to the development of more effective and targeted compounds for crop protection and management.
Used in Materials Science:
[[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl](methoxymethyl)amino]methanol can be used as a component in the development of advanced materials, such as polymers, coatings, or adhesives. Its unique structure and functional groups may provide specific properties or improve the performance of these materials in various applications.
Further research and analysis are necessary to fully understand the properties and potential uses of [[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl](methoxymethyl)amino]methanol, as well as to explore its synthesis and potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13822-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,8,2 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13822-63:
(7*1)+(6*3)+(5*8)+(4*2)+(3*2)+(2*6)+(1*3)=94
94 % 10 = 4
So 13822-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H28N6O6/c1-22-7-18(6-21)12-15-13(19(8-23-2)9-24-3)17-14(16-12)20(10-25-4)11-26-5/h21H,6-11H2,1-5H3