138405-02-4 Usage
Chemical structure
Aminoacetate derivative with two adamantane groups and a phenylmethoxycarbonyl group.
Unique three-dimensional structure
Presence of adamantane rings in the molecule.
Potential applications
Drug design and medicinal chemistry due to its unique structure.
Biological activity
May have biological activity, but further research is needed to understand its properties and potential uses.
Molecular complexity
Long and complicated name indicating a complex structure.
Carbonyl groups
Contains carbonyl groups within the adamantane-1-carbonylamino moieties.
Amino groups
Contains amino groups within the adamantane-1-carbonylamino moieties.
Ester linkage
Presence of an ester linkage with the phenylmethoxycarbonyl group.
Phenyl group
Contains a phenyl group within the phenylmethoxycarbonyl moiety.
Methoxy group
Contains a methoxy group within the phenylmethoxycarbonyl moiety.
Chiral centers
The molecule may have chiral centers, which could lead to different stereoisomers with varying properties.
Solubility
The solubility of the compound in various solvents is not mentioned, but it may vary depending on the polarity and hydrogen bonding capabilities of the solvents.
Stability
The stability of the compound under different conditions (e.g., temperature, pH) is not mentioned, but it may be influenced by the presence of various functional groups in the molecule.
Synthesis
The synthesis of this complex compound likely involves multiple steps and the use of protecting groups to control the formation of the desired product.
Check Digit Verification of cas no
The CAS Registry Mumber 138405-02-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,4,0 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 138405-02:
(8*1)+(7*3)+(6*8)+(5*4)+(4*0)+(3*5)+(2*0)+(1*2)=114
114 % 10 = 4
So 138405-02-4 is a valid CAS Registry Number.
InChI:InChI=1/C35H47N3O6/c39-30(20-38-33(42)43-21-22-4-2-1-3-5-22)44-29(18-36-31(40)34-12-23-6-24(13-34)8-25(7-23)14-34)19-37-32(41)35-15-26-9-27(16-35)11-28(10-26)17-35/h1-5,23-29H,6-21H2,(H,36,40)(H,37,41)(H,38,42)