141839-02-3 Usage
Chemical compound
A substance formed from two or more elements chemically bonded together in a fixed proportion.
Hexane derivative
A compound derived from hexane, an alkane with six carbon atoms.
Two 3,4-dihydroxy-2-benzylpyrrolidine moieties
The compound has two of these specific molecular structures attached to its backbone.
Polyhydroxy compounds
Contains multiple hydroxyl (OH) functional groups.
Hydroxyl groups
Functional groups containing an oxygen and hydrogen atom (OH).
Antioxidant properties
Capable of inhibiting the oxidation of other molecules.
Chelating properties
Ability to form multiple bonds with a central metal ion, creating a stable complex.
Potential applications
Pharmaceutical, industrial processes, polymers, and plastics production.
Chemical structure
The specific arrangement of atoms and bonds in the compound.
Further research
The compound's structure and properties make it an interesting subject for additional study.
Development of new applications
The potential for discovering and creating new uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 141839-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,8,3 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 141839-02:
(8*1)+(7*4)+(6*1)+(5*8)+(4*3)+(3*9)+(2*0)+(1*2)=123
123 % 10 = 3
So 141839-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C28H40N2O4.2ClH/c31-25-19-29(23(27(25)33)17-21-11-5-3-6-12-21)15-9-1-2-10-16-30-20-26(32)28(34)24(30)18-22-13-7-4-8-14-22;;/h3-8,11-14,23-28,31-34H,1-2,9-10,15-20H2;2*1H