142810-49-9 Usage
General Description
"Cyclohexanecarboxamide, N-(4-chlorophenyl)- is a chemical compound that belongs to the class of organic compounds known as N-arylamides. These are organic compounds containing an N-arylamide moiety, which is a carboxamide group substituted with an aryl group. It specifically involves a cyclohexane ring, a carboxamide group, and a 4-chlorophenyl group. This chemical is not naturally occurring and is primarily synthesized in laboratories for use in various industrial applications. Its properties, reactivity, and potential hazards should be thoroughly understood before handling.
Check Digit Verification of cas no
The CAS Registry Mumber 142810-49-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,8,1 and 0 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 142810-49:
(8*1)+(7*4)+(6*2)+(5*8)+(4*1)+(3*0)+(2*4)+(1*9)=109
109 % 10 = 9
So 142810-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H16ClNO/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,15,16)