143075-33-6 Usage
Description
1-((5-Methyl-1H-imidazol-4-yl)methyl)-3-(2-thienyl)-2(1H)-pyridinone monohydrochloride is a pyridinone derivative chemical compound utilized in pharmaceutical research. It features a methyl imidazole group and a thienyl group attached to the pyridinone ring, with the monohydrochloride salt form being commonly employed for potential medication development due to its pharmacological properties. 1-((5-Methyl-1H-imidazol-4-yl)methyl)-3-(2-thienyl)-2(1H)-pyridinone m onohydrochloride's structure indicates its potential as a selective modulator of specific biological targets, making it a promising candidate for treating various diseases. Further research is necessary to fully comprehend its potential applications and effects.
Uses
Used in Pharmaceutical Research:
1-((5-Methyl-1H-imidazol-4-yl)methyl)-3-(2-thienyl)-2(1H)-pyridinone monohydrochloride is used as a research compound for the development of potential medications due to its pharmacological properties and its potential as a selective modulator of specific biological targets.
Used in Drug Development:
In the pharmaceutical industry, 1-((5-Methyl-1H-imidazol-4-yl)methyl)-3-(2-thienyl)-2(1H)-pyridinone monohydrochloride is used as a lead compound for designing new drugs targeting various diseases, given its structural characteristics and potential interactions with biological targets.
Used in Biological Target Modulation:
1-((5-Methyl-1H-imidazol-4-yl)methyl)-3-(2-thienyl)-2(1H)-pyridinone monohydrochloride is used as a modulator of specific biological targets, which may contribute to the treatment of various diseases by selectively interacting with these targets and influencing their activity.
Check Digit Verification of cas no
The CAS Registry Mumber 143075-33-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,0,7 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 143075-33:
(8*1)+(7*4)+(6*3)+(5*0)+(4*7)+(3*5)+(2*3)+(1*3)=106
106 % 10 = 6
So 143075-33-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H13N3OS.ClH/c1-10-12(16-9-15-10)8-17-6-2-4-11(14(17)18)13-5-3-7-19-13;/h2-7,9H,8H2,1H3,(H,15,16);1H