143121-08-8 Usage
Chemical class
Derivative of pyrrolidinecarboxylic acid
Explanation
1-Pyrrolidinecarboxylic acid 2,4-dichloro-5-hydroxyphenyl ester is derived from pyrrolidinecarboxylic acid by adding a 2,4-dichloro-5-hydroxyphenyl ester group.
Explanation
The compound consists of a pyrrolidinecarboxylic acid core with a 2,4-dichloro-5-hydroxyphenyl ester group attached to it.
Explanation
The compound is used in the field of organic chemistry for research and development purposes.
Explanation
1-Pyrrolidinecarboxylic acid 2,4-dichloro-5-hydroxyphenyl ester may possess various biological activities, making it a potential candidate for pharmaceutical research and drug development.
Explanation
This chemical should be handled with caution, as it may have potential health and environmental hazards associated with its use.
Explanation
Additional research and testing are required to fully understand the properties and potential applications of 1-Pyrrolidinecarboxylic acid 2,4-dichloro-5-hydroxyphenyl ester.
Molecular structure
2,4-dichloro-5-hydroxyphenyl ester group attached to a pyrrolidinecarboxylic acid
Usage
Organic chemistry research
Potential applications
Pharmaceutical research and drug development
Safety concerns
Potential health and environmental hazards
Further research
Necessary to understand properties and applications
Check Digit Verification of cas no
The CAS Registry Mumber 143121-08-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,1,2 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 143121-08:
(8*1)+(7*4)+(6*3)+(5*1)+(4*2)+(3*1)+(2*0)+(1*8)=78
78 % 10 = 8
So 143121-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11Cl2NO3/c12-7-5-8(13)10(6-9(7)15)17-11(16)14-3-1-2-4-14/h5-6,15H,1-4H2
