144292-40-0 Usage
General Description
2,3-Difluoro-4-iodophenol, often represented by the formula C6H3F2IO, is a synthetic chemical compound that belongs to the category of organofluorines and organoiodides. It carries both fluorine and iodine substituents, which are well-regarded for their versatility in various chemical reactions, and a phenol group, characterized by a hydroxyl group (-OH) attached to an aromatic phenyl ring, known for its reactivity and potential as a building block in synthesizing more complex compounds. Its tri-substituted phenol structure has potential uses in the pharmaceutical industry, as it could be incorporated in advanced synthetic stages of drug development. However, detailed information regarding its precise applications, potential safety hazards, and environmental impact is limited, emphasizing the need for further studies.
Check Digit Verification of cas no
The CAS Registry Mumber 144292-40-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,4,2,9 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 144292-40:
(8*1)+(7*4)+(6*4)+(5*2)+(4*9)+(3*2)+(2*4)+(1*0)=120
120 % 10 = 0
So 144292-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F2IO/c7-5-3(9)1-2-4(10)6(5)8/h1-2,10H
144292-40-0Relevant articles and documents
Liquid crystal compounds and compositions
-
, (2008/06/13)
Smetic C liquid crystal compounds, represented by the following formula (1) or (2) are disclosed. R1-O-A1-C≡C-A2-CO-(O)P-R2 (2)wherein R1and R2are C1-18 alkyl groups; A is a cyclic group, such as aubstituted or unsubstituted 1,4-phenylene group, X is direct bond, O or C#IDW#C; Y is -C#IDW#C- or -CH2CH2-; one of A1and A2is 1,4-phenylene group and the other is, 2,3-difluoro-1,4-phenylene group; and p is 0 or 1. These compounds can provide ferroelectric liquid crystal composition of low viscosity, and are useful as a component giving negative dielectric anisotropy and enlarging a temperature range showing smetic C phase.
