145069-53-0 Usage
Description
4-Ethynyl-2-fluoro-1-methyl-benzene, a chemical compound with the molecular formula C9H7F, is a derivative of benzene featuring a fluorine atom, a methyl group, and an ethynyl (acetylene) group attached to the carbon ring. Its unique structure and properties make it a valuable building block in organic synthesis and pharmaceutical research, as well as a reagent in chemical reactions.
Uses
Used in Organic Synthesis:
4-Ethynyl-2-fluoro-1-methyl-benzene is used as a building block for the synthesis of more complex molecules, contributing to the development of new materials and compounds with specific applications in various industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-Ethynyl-2-fluoro-1-methyl-benzene is utilized as a key intermediate in the development of new drugs, owing to its potential to form novel molecular structures with therapeutic properties.
Used in Specialty Chemicals Manufacturing:
4-ETHYNYL-2-FLUORO-1-METHYL-BENZENE is employed in the production of specialty chemicals, where its unique characteristics are leveraged to create high-value products for specific applications.
Used as a Reagent in Chemical Reactions:
4-Ethynyl-2-fluoro-1-methyl-benzene serves as a reagent in various chemical processes, facilitating the synthesis of desired products and enhancing the efficiency of these reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 145069-53-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,0,6 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 145069-53:
(8*1)+(7*4)+(6*5)+(5*0)+(4*6)+(3*9)+(2*5)+(1*3)=130
130 % 10 = 0
So 145069-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7F/c1-3-8-5-4-7(2)9(10)6-8/h1,4-6H,2H3
145069-53-0Relevant articles and documents
Liquid crystal compound containing butadiyne structure and liquid crystal composition and application thereof
-
Paragraph 0124; 0132-0133, (2021/05/08)
The invention relates to a liquid crystal compound containing a butadiyne structure. The liquid crystal compound is represented by a general formula I. The invention also relates to a liquid crystal composition which at least comprises the compound repres
Acetylene derivatives, and liquid crystal composition and liquid crystal display device each comprising the same
-
, (2008/06/13)
The present invention provides new liquid crystalline compounds having a high optical anisotropy value and excellent compatibility with the other liquid crystals, and liquid crystal composition comprising the compounds.The liquid crystalline compounds are represented by the general formula (1): wherein H1, H2, H3, H4, H5, H6, H7, H8, H9, H10, H11 and H12, each independently, represent H, F or Cl, at least one of H1, H2, H3, H4, H9, H10, H11 and H12 is F or Cl, R1 represents an alkyl group of C1-20, in which methylene groups may be replaced by —O—, —S—, —Si—, —CH=CH— or —C≡C—, any hydrogen atoms may be replaced by a halogen atom, and Y1 is replaced by R1, F, Cl, Br, I or a cyano group.
