145300-46-5 Usage
General Description
2-(4-ethylphenyl)-1,3-thiazolane is a chemical compound with the molecular formula C12H15NS. It is a thiazolane derivative, which is a five-membered heterocyclic ring containing both nitrogen and sulfur atoms. The compound contains an ethylphenyl group, which is a benzene ring with an ethyl substituent attached at the 4th position. Thiazolanes have been investigated for their potential pharmacological and biological activities, such as antimicrobial, anticancer, and antiviral properties. The compound may have potential applications in the development of pharmaceuticals and agrochemicals due to its unique chemical structure and potential biological activities. However, further research and testing would be needed to fully understand the properties and potential uses of 2-(4-ethylphenyl)-1,3-thiazolane.
Check Digit Verification of cas no
The CAS Registry Mumber 145300-46-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,3,0 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 145300-46:
(8*1)+(7*4)+(6*5)+(5*3)+(4*0)+(3*0)+(2*4)+(1*6)=95
95 % 10 = 5
So 145300-46-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NS/c1-2-9-3-5-10(6-4-9)11-12-7-8-13-11/h3-6,11-12H,2,7-8H2,1H3