14541-93-6 Usage
General Description
6-Nitro-benzooxazole-2-thiol is a chemical compound with the molecular formula C7H4N2O3S. It is a nitroaromatic compound with a benzooxazole ring and a thiol group attached at the 2-position. 6-NITRO-BENZOOXAZOLE-2-THIOL is often used as a building block in the synthesis of various organic compounds and pharmaceuticals. It has potential applications in the pharmaceutical industry due to its biological activities, such as antimicrobial and anticancer properties. Additionally, 6-nitro-benzooxazole-2-thiol is also used as a reagent in chemical reactions, particularly in the formation of carbon-sulfur bonds. Its chemical structure and properties make it a valuable tool for scientists and researchers in various fields, including medicinal chemistry and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 14541-93-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,4 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14541-93:
(7*1)+(6*4)+(5*5)+(4*4)+(3*1)+(2*9)+(1*3)=96
96 % 10 = 6
So 14541-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N2O3S/c10-9(11)4-1-2-5-6(3-4)12-7(13)8-5/h1-3H,(H,8,13)
