14549-67-8 Usage
Chemical structure
The compound consists of a piperazine ring with a pyridine group and a 2,4-dimethoxyphenyl group attached.
Pharmaceutical research
It is commonly used in pharmaceutical research as a potential therapeutic agent for various conditions.
Psychiatric disorders
The compound has been studied for its potential use in treating psychiatric disorders due to its ability to interact with neurotransmitter receptors.
Cancer treatment
It has been investigated as a potential antitumor agent, making it a candidate for further research in cancer treatment.
Interaction with neurotransmitter receptors
The compound's ability to interact with neurotransmitter receptors is a key factor in its potential therapeutic applications.
Drug candidate
Its chemical structure and properties make it a promising candidate for further investigation and development as a drug.
Dimethoxyphenyl group
The presence of the 2,4-dimethoxyphenyl group in the compound contributes to its unique properties and potential therapeutic applications.
Amino and pyridyl groups
The 3-amino-4-pyridyl group attached to the piperazine ring is responsible for the compound's interaction with neurotransmitter receptors and its potential therapeutic effects.
Molecular weight
The molecular weight of the compound is an important factor in determining its pharmacokinetics and pharmacodynamics.
Solubility
The solubility of the compound in various solvents can impact its formulation and administration in potential therapeutic applications.
Stability
The stability of the compound under different conditions (e.g., temperature, pH) is crucial for its development as a drug candidate.
Toxicity
The compound's toxicity profile is an essential aspect to consider during the drug development process, as it can impact its safety and efficacy.
Synergistic effects
The compound may have synergistic effects when combined with other therapeutic agents, which could enhance its potential therapeutic applications.
Structure-activity relationship
Understanding the relationship between the compound's structure and its biological activity can help guide the design of more potent and selective drug candidates.
Patentability
The compound's unique structure and potential therapeutic applications may make it eligible for patent protection, which could encourage further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 14549-67-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,4 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 14549-67:
(7*1)+(6*4)+(5*5)+(4*4)+(3*9)+(2*6)+(1*7)=118
118 % 10 = 8
So 14549-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H22N4O2/c1-22-13-3-4-16(17(11-13)23-2)21-9-7-20(8-10-21)15-5-6-19-12-14(15)18/h3-6,11-12H,7-10,18H2,1-2H3