14556-93-5 Usage
General Description
2,5-Dimethoxy-4-(2-iodoacetylamino)phenyl thiocyanate is a chemical compound with the molecular formula C13H13IN2O3S. It is a thiocyanate derivative of 2,5-dimethoxy-4-(2-iodoacetylamino)phenyl, and it contains a thiocyanate group attached to the benzene ring. 2,5-Dimethoxy-4-(2-iodoacetylamino)phenyl thiocyanate is commonly used in organic synthesis and pharmaceutical research due to its unique chemical properties and potential pharmacological applications. It may also have potential uses as a building block in the creation of new drug compounds or as a research tool in drug discovery. However, its specific biological activities and potential therapeutic uses have not yet been fully characterized. Additional research is needed to fully understand the potential applications and biological effects of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 14556-93-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,5 and 6 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14556-93:
(7*1)+(6*4)+(5*5)+(4*5)+(3*6)+(2*9)+(1*3)=115
115 % 10 = 5
So 14556-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H11IN2O3S/c1-16-8-4-10(18-6-13)9(17-2)3-7(8)14-11(15)5-12/h3-4H,5H2,1-2H3,(H,14,15)