14575-25-8 Usage
Description
(2E,4E)-1-PHENYL-4-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-2-EN-1-ONE is a complex chemical compound characterized by a phenyl group attached to a butenone backbone, featuring a 1,3,3-trimethyl-1,3-dihydro-2H-indol-2-ylidene substituent. This intricate molecular structure suggests potential applications in various fields due to its unique reactivity and properties.
Uses
Used in Organic Synthesis:
(2E,4E)-1-PHENYL-4-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-2-EN-1-ONE is used as a key intermediate in organic synthesis for the development of novel compounds with specific reactivity and properties. Its complex structure allows for the creation of new molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (2E,4E)-1-PHENYL-4-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-2-EN-1-ONE is used as a building block for the synthesis of new drug candidates. Its unique molecular structure may contribute to the development of innovative medications with improved efficacy and reduced side effects.
Used in Materials Science:
(2E,4E)-1-PHENYL-4-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-2-EN-1-ONE is utilized in materials science for the design and synthesis of advanced materials with specific properties. Its complex structure can be employed to create materials with unique characteristics, such as improved stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 14575-25-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,5,7 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 14575-25:
(7*1)+(6*4)+(5*5)+(4*7)+(3*5)+(2*2)+(1*5)=108
108 % 10 = 8
So 14575-25-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H21NO/c1-21(2)17-12-7-8-13-18(17)22(3)20(21)15-9-14-19(23)16-10-5-4-6-11-16/h4-15H,1-3H3/b14-9+,20-15+