147-18-2 Usage
Functional groups
Phenyl group
Chloro group
Methyl group
Propyl group
Indol-3-yl group
Carboxylic acid
Potential properties
Anti-inflammatory agent
Pharmaceutical applicationslore, this chemical compound has a complex structure with potential pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 147-18-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,4 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 147-18:
(5*1)+(4*4)+(3*7)+(2*1)+(1*8)=52
52 % 10 = 2
So 147-18-2 is a valid CAS Registry Number.
InChI:InChI=1/C21H22ClNO2/c1-3-4-19-18(12-21(24)25)17-11-14(2)5-10-20(17)23(19)13-15-6-8-16(22)9-7-15/h5-11H,3-4,12-13H2,1-2H3,(H,24,25)