147597-66-8 Usage
General Description
2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid is a chemical compound with potential applications in bioconjugation and molecular imaging. It contains a benzyl group linked to a triazacyclononane core, which forms a stable complex with various metal ions such as copper, gallium, and indium. This complex has been explored for use in positron emission tomography (PET) imaging, making it a promising candidate for the development of new radiopharmaceuticals for cancer diagnosis and treatment. Additionally, the isothiocyanate functional group allows for the covalent attachment of the compound to biomolecules, enabling the development of targeted imaging probes and therapeutics. Overall, 2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid is a versatile chemical that shows potential for various biomedical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 147597-66-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,5,9 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 147597-66:
(8*1)+(7*4)+(6*7)+(5*5)+(4*9)+(3*7)+(2*6)+(1*6)=178
178 % 10 = 8
So 147597-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H24N4O6S/c25-18(26)11-22-5-6-23(12-19(27)28)10-17(24(8-7-22)13-20(29)30)9-15-1-3-16(4-2-15)21-14-31/h1-4,7-8,17H,5-6,9-13H2,(H,25,26)(H,27,28)(H,29,30)/b8-7-