147676-55-9 Usage
Description
N-Desethyl Acetildenafil is a pyrazolopyrimidinone derivative that functions as a cGMP phosphodiesterase inhibitor. It is characterized by its light yellow foam appearance and is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
N-Desethyl Acetildenafil is used as a cGMP phosphodiesterase inhibitor for enhancing the levels of cyclic guanosine monophosphate (cGMP) in the body. This increase in cGMP levels can lead to vasodilation, which may be beneficial in treating conditions such as erectile dysfunction and pulmonary hypertension.
Used in Research and Development:
In the field of research and development, N-Desethyl Acetildenafil serves as a valuable compound for studying the mechanisms of cGMP phosphodiesterase and its role in various physiological processes. This knowledge can contribute to the development of new therapeutic strategies and drugs targeting cGMP-related pathways.
Used in Drug Design and Synthesis:
N-Desethyl Acetildenafil's unique chemical properties make it a useful starting point for the design and synthesis of new drugs with improved efficacy and selectivity. Its pyrazolopyrimidinone structure can be modified to create novel compounds with potential applications in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 147676-55-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,6,7 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 147676-55:
(8*1)+(7*4)+(6*7)+(5*6)+(4*7)+(3*6)+(2*5)+(1*5)=169
169 % 10 = 9
So 147676-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H30N6O3/c1-4-6-17-20-21(28(3)27-17)23(31)26-22(25-20)16-13-15(7-8-19(16)32-5-2)18(30)14-29-11-9-24-10-12-29/h7-8,13,24H,4-6,9-12,14H2,1-3H3,(H,25,26,31)