147821-49-6 Usage
Description
[[2-ethyl-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxyphenyl]methylamino]methanethioic acid is a complex organic compound characterized by its intricate molecular structure. It features an aromatic ring, an amino group, and a thioic acid group, along with an oxane ring and an ethyl group. The presence of a chiral center and multiple hydroxyl groups suggests its potential for hydrogen bonding and interactions with biological systems. Further experimental studies are necessary to fully understand its properties and possible applications.
Uses
Used in Pharmaceutical Industry:
[[2-ethyl-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxyphenyl]methylamino]methanethioic acid is used as a potential pharmaceutical candidate for various applications due to its ability to form hydrogen bonds and interact with biological systems. Its complex structure with multiple functional groups may allow it to modulate specific biological pathways or target certain receptors, making it a promising compound for drug development.
Used in Chemical Research:
In the field of chemical research, [[2-ethyl-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxyphenyl]methylamino]methanethioic acid can be used as a starting material or a building block for the synthesis of other complex organic molecules. Its unique structure and functional groups may enable the creation of novel compounds with specific properties and potential applications in various industries.
Used in Material Science:
[[2-ethyl-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxyphenyl]methylamino]methanethioic acid's structural features, including the aromatic ring and the thioic acid group, may provide it with unique physical or chemical properties that could be exploited in the development of new materials. [[2-ethyl-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxyphenyl]methylamino]methanethioic acid could be used as a component in the design of advanced materials for applications such as sensors, catalysts, or coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 147821-49-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,8,2 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 147821-49:
(8*1)+(7*4)+(6*7)+(5*8)+(4*2)+(3*1)+(2*4)+(1*9)=146
146 % 10 = 6
So 147821-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H23NO6S/c1-3-21-16(24)17-8-10-4-6-11(7-5-10)23-15-14(20)13(19)12(18)9(2)22-15/h4-7,9,12-15,18-20H,3,8H2,1-2H3,(H,17,24)
147821-49-6Relevant articles and documents
Synthesis of novel hypotensive aromatic thiocarbamate glycosides
Saleem, Rubeena,Meinwald, Jerrold
, p. 391 - 394 (2007/10/03)
Syntheses of hypotensive thiocarbamate glycosides from Moringa oleifera are described. The route involves, first, the condensation of the sugar moiety with p-hydroxybenzonitrile to give glycoside 2, then subsequent reduction of 2 to the glycosidic benzyla