148-64-1 Usage
General Description
The chemical "N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridylethylenediamine 2-hydroxy-1,2,3-propanetricarboxylate" is a complex compound with a long name. It is a derivative of ethylenediamine, with a pyridyl group and a chlorine-substituted thienyl group attached. Additionally, it contains a 2-hydroxy-1,2,3-propanetricarboxylate moiety. N-[(5-chloro-2-thienyl)methyl]-N',N'-dimethyl-N-2-pyridylethylenediamine 2-hydroxy-1,2,3-propanetricarboxylate likely has a variety of applications, potentially in pharmaceuticals, agriculture, or other industries due to its diverse chemical structure and potential for complex interactions with biological systems. However, further research and analysis would be necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 148-64-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,4 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 148-64:
(5*1)+(4*4)+(3*8)+(2*6)+(1*4)=61
61 % 10 = 1
So 148-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H18ClN3S.C6H8O7/c1-17(2)9-10-18(14-5-3-4-8-16-14)11-12-6-7-13(15)19-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8H,9-11H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)