148401-38-1 Usage
General Description
4-Amino-8-fluoroquinoline is a chemical compound with the molecular formula C9H7FN2. It is a quinoline derivative that contains an amino group and a fluorine atom. 4-AMINO-8-FLUOROQUINOLINE is commonly used as a building block in the synthesis of pharmaceuticals, especially antimalarial drugs. It is known for its antiparasitic and antibacterial properties, making it a valuable ingredient in the development of new medications. Its molecular structure and reactivity make it a versatile chemical with potential applications in various fields, including medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 148401-38-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,4,0 and 1 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 148401-38:
(8*1)+(7*4)+(6*8)+(5*4)+(4*0)+(3*1)+(2*3)+(1*8)=121
121 % 10 = 1
So 148401-38-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FN2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H,(H2,11,12)
148401-38-1Relevant articles and documents
N-(4-pyridyl or 4-quinolinyl) arylacetamide and 4-(aralkoxy or aralkylamino) pyridine pesticides
-
, (2008/06/13)
N-(4-Pyridyl or 4-quinolinyl) arylacetamides, for example N-((3-chloro-2-ethyl)-4-pyridyl)(4-(4-chlorophenoxy) phenyl)-acetamide, and 4-(aralkyoxy or aralkylamino)pyridines, for example 4-[2-[4-(2,2,2-trifluoroethoxy)phenyl]ethoxy]pyridine, are active aga
