14960-63-5 Usage
Appearance
Pale yellow to light brown solid The compound's physical form and color, which can vary depending on the purity and conditions.
Solubility
Soluble in organic solvents The compound can dissolve in certain organic solvents, making it suitable for use in organic synthesis.
Odor
Characteristic The compound has a distinct smell, which may be relevant for handling and storage purposes.
Versatile intermediate
Capable of participating in various chemical reactions The compound can engage in reactions such as condensation and oxidation, allowing for the synthesis of a wide range of functionalized indole derivatives.
Potential applications
Pharmaceutical industry Due to its ability to produce various derivatives and exhibit interesting biological activities, the compound has potential uses in drug discovery and development.
Biological activities
Exhibits interesting properties The compound has shown promising biological properties, making it a valuable tool for research and development in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 14960-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,9,6 and 0 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14960-63:
(7*1)+(6*4)+(5*9)+(4*6)+(3*0)+(2*6)+(1*3)=115
115 % 10 = 5
So 14960-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO2/c1-19-17-15-10-6-5-9-13(15)14(11-18)16(17)12-7-3-2-4-8-12/h2-11H,1H3
