15026-82-1 Usage
Description
1-(4-Chloro-benzoylamino)-cyclopentanecarboxylic acid is a chemical compound characterized by its molecular formula C15H15ClNO3. It is a derivative of cyclopentanecarboxylic acid, featuring a 4-chloro-benzoylamino group attached to its structure. This white to off-white powder is frequently utilized in the realms of organic synthesis and pharmaceutical research, showcasing its versatility and importance in the development of various pharmaceutical compounds.
Uses
Used in Pharmaceutical Research:
1-(4-Chloro-benzoylamino)-cyclopentanecarboxylic acid is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structural features allow it to serve as a key component in the creation of new and potentially effective medications.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(4-Chloro-benzoylamino)-cyclopentanecarboxylic acid is employed as a precursor in the preparation of other chemical entities. Its presence in the synthesis process can lead to the development of novel compounds with diverse applications.
Used in Medicinal Chemistry:
Due to its structural features, 1-(4-Chloro-benzoylamino)-cyclopentanecarboxylic acid may possess potential biological activities. This makes it a valuable compound for further research and development in medicinal chemistry, where it could contribute to the discovery of new therapeutic agents or treatments for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 15026-82-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,0,2 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15026-82:
(7*1)+(6*5)+(5*0)+(4*2)+(3*6)+(2*8)+(1*2)=81
81 % 10 = 1
So 15026-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H14ClNO3/c14-10-5-3-9(4-6-10)11(16)15-13(12(17)18)7-1-2-8-13/h3-6H,1-2,7-8H2,(H,15,16)(H,17,18)
