150449-98-2 Usage
Description
2,4-Dichloroquinazoline-6-carbonitrile is an organic compound with the molecular formula C8H3Cl2N3. It is a derivative of quinazoline, a fused heterocyclic compound consisting of a benzene ring fused to a pyrimidine ring. The presence of two chlorine atoms at the 2nd and 4th positions, along with a nitrile group at the 6th position, gives this compound unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2,4-Dichloroquinazoline-6-carbonitrile is used as a reagent for the discovery of histamine receptor inhibitors. Histamine receptors play a crucial role in various physiological processes, including immune responses, neurotransmission, and the regulation of blood pressure. Inhibiting these receptors can be beneficial in treating conditions such as allergies, asthma, and gastric ulcers. The compound's unique structure allows it to interact with histamine receptors, potentially leading to the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 150449-98-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,0,4,4 and 9 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 150449-98:
(8*1)+(7*5)+(6*0)+(5*4)+(4*4)+(3*9)+(2*9)+(1*8)=132
132 % 10 = 2
So 150449-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H3Cl2N3/c10-8-6-3-5(4-12)1-2-7(6)13-9(11)14-8/h1-3H
150449-98-2Relevant articles and documents
Method of treating a patient having a precancerous lesions with amide quinazoline derivatives
-
, (2008/06/13)
Derivatives of quinazoline are useful for the treatment of patients having precancerous lesions. These compounds are also useful to inhibit the growth of neoplastic cells.
