151055-79-7 Usage
Description
[3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL, with the molecular formula C11H12N2O, is a white to off-white solid chemical compound. It features a phenyl group connected to a methanol group through a 1H-imidazol-1-ylmethyl linker, making it structurally related to imidazole, a heterocyclic aromatic compound. [3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL is utilized in pharmaceutical and chemical research due to its potential pharmacological activities stemming from its imidazol-1-ylmethyl and phenyl components, which can be beneficial in drug development and medicinal chemistry.
Uses
Used in Pharmaceutical Research:
[3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL is used as a chemical intermediate for the development of various pharmaceutical compounds. Its unique structure, including the imidazol-1-ylmethyl and phenyl moieties, allows for potential applications in creating new drugs with specific therapeutic properties.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, [3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL serves as a key building block for designing and synthesizing novel molecules with potential biological activities. Its structural features can be exploited to create compounds that target specific receptors or enzymes, which may lead to the discovery of new therapeutic agents.
Used in Chemical Synthesis:
[3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL is utilized as a reagent in chemical synthesis, particularly for creating complex organic molecules. Its versatile structure allows for various chemical reactions, making it a valuable component in the synthesis of a wide range of compounds for different applications, including pharmaceuticals, agrochemicals, and materials science.
Used in Drug Development:
[3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL is used as a lead compound in drug development, where its structure can be optimized to enhance its pharmacological properties. The imidazol-1-ylmethyl and phenyl groups can be modified to improve the compound's potency, selectivity, and pharmacokinetic profile, potentially leading to the creation of more effective drugs.
Used in Chemical Analysis:
[3-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL can be employed as a reference material or standard in chemical analysis, helping to validate analytical methods and ensure the accuracy of experimental results. Its distinct structure and properties make it suitable for use in various analytical techniques, such as chromatography, spectroscopy, and mass spectrometry.
Check Digit Verification of cas no
The CAS Registry Mumber 151055-79-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,0,5 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 151055-79:
(8*1)+(7*5)+(6*1)+(5*0)+(4*5)+(3*5)+(2*7)+(1*9)=107
107 % 10 = 7
So 151055-79-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O/c14-8-11-3-1-2-10(6-11)7-13-5-4-12-9-13/h1-6,9,14H,7-8H2
151055-79-7Relevant articles and documents
Benzothiazole Formulations and Use Thereof
-
Page/Page column 22, (2010/11/30)
The present invention is related to macrogol glyceride pharmaceutical formulations containing benzothiazole derivatives. In particular, the invention is related to benzothiazole stearoyl macrogol pharmaceutical formulations, method of preparation and use thereof.
