151337-74-5 Usage
General Description
2,4-di-(2-hydroxyethoxy)ethyl-deuteroporphyrin IX is a synthetic chemical compound that is a derivative of deuteroporphyrin IX. It contains two hydroxyethoxy groups and two ethyl groups attached to the porphyrin ring. 2,4-di-(2-hydroxyethoxy)ethyl-deuteroporphyrin IX has potential applications in the field of photodynamic therapy, which uses light and a photosensitizing chemical to kill cancer cells. It is being studied for its ability to selectively accumulate in tumor tissues and produce reactive oxygen species when exposed to light, leading to the destruction of cancer cells. Additionally, 2,4-di-(2-hydroxyethoxy)ethyl-deuteroporphyrin IX may also have applications in other areas such as fluorescence imaging and photochemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 151337-74-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,3,3 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 151337-74:
(8*1)+(7*5)+(6*1)+(5*3)+(4*3)+(3*7)+(2*7)+(1*4)=115
115 % 10 = 5
So 151337-74-5 is a valid CAS Registry Number.
InChI:InChI=1/C40H50N4O8/c1-21-27(9-11-37(47)49-7)33-20-34-28(10-12-38(48)50-8)22(2)30(42-34)18-35-40(26(6)52-16-14-46)24(4)32(44-35)19-36-39(25(5)51-15-13-45)23(3)31(43-36)17-29(21)41-33/h17-20,25-26,43-46H,9-16H2,1-8H3/b29-17-,30-18-,31-17-,32-19-,33-20-,34-20-,35-18-,36-19-