151539-60-5 Usage
Description
(E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine is a complex chemical compound that features a xanthine core, a (E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl) side chain, and two propyl groups. (E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine is characterized by its intricate molecular structure, which includes a purine base, a benzodioxane ring, and additional alkyl groups that contribute to its unique properties. The specific characteristics and potential applications of this compound are likely to be influenced by its interactions with biological systems and its utility in drug development or scientific research.
Uses
Used in Pharmaceutical Research:
(E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine is used as a compound in pharmaceutical research for its potential interactions with biological systems. The presence of the xanthine core and the benzodioxane ring may provide opportunities for the development of new drugs targeting specific receptors or enzymes.
Used in Drug Development:
In the drug development industry, (E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine is used as a starting material or a structural component for the synthesis of novel therapeutic agents. Its complex structure may offer unique pharmacological properties that can be harnessed to create new medicines.
Used in Chemical Synthesis:
(E)-8-(2-(1,4-Benzodioxan-6-yl)vinyl)-7-methyl-1,3-dipropylxanthine is also used as a building block in chemical synthesis, particularly for the creation of more complex molecules with potential applications in various fields, including materials science, agrochemistry, and specialty chemicals.
Please note that the specific applications and uses mentioned above are hypothetical and would depend on the actual properties and characteristics of the compound once it has been thoroughly studied and tested.
Check Digit Verification of cas no
The CAS Registry Mumber 151539-60-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,5,3 and 9 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 151539-60:
(8*1)+(7*5)+(6*1)+(5*5)+(4*3)+(3*9)+(2*6)+(1*0)=125
125 % 10 = 5
So 151539-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N4O4/c1-4-10-25-20-19(21(27)26(11-5-2)22(25)28)24(3)18(23-20)9-7-15-6-8-16-17(14-15)30-13-12-29-16/h6-9,14H,4-5,10-13H2,1-3H3/b9-7+