151945-84-5 Usage
Description
4-CHLORO-3-FLUOROACETOPHENONE is a halogenated benzene derivative characterized by the presence of a chlorine atom at the 4th position and a fluorine atom at the 3rd position on the aromatic ring. It is a versatile compound used in various applications due to its unique chemical properties.
Uses
Used in Organic Synthesis:
4-CHLORO-3-FLUOROACETOPHENONE is used as a synthetic intermediate for the production of various organic compounds. Its unique halogenated structure allows for a range of chemical reactions, making it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-CHLORO-3-FLUOROACETOPHENONE is used as a key intermediate in the development of new drugs. Its specific functional groups enable the creation of novel molecular structures with potential therapeutic applications.
Used in Agrochemical Industry:
4-CHLORO-3-FLUOROACETOPHENONE is also utilized in the agrochemical industry for the synthesis of new pesticides and other crop protection agents. Its unique chemical properties contribute to the development of more effective and targeted products.
Used in Chemical Research:
In the field of chemical research, 4-CHLORO-3-FLUOROACETOPHENONE serves as a valuable compound for studying various reaction mechanisms and exploring new synthetic pathways. Its unique structure provides researchers with opportunities to investigate novel chemical transformations and develop innovative methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 151945-84-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,1,9,4 and 5 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 151945-84:
(8*1)+(7*5)+(6*1)+(5*9)+(4*4)+(3*5)+(2*8)+(1*4)=145
145 % 10 = 5
So 151945-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO/c1-5(11)6-2-3-7(9)8(10)4-6/h2-4H,1H3
151945-84-5Relevant articles and documents
Oxazolidone derivatives as PR modulators
-
, (2008/06/13)
Compounds of the following structure are described: wherein R1, R2, R5, R6, V, X, Y, Z and Q are described herein, or a pharmaceutically acceptable salt, tautomer, metabolite or prodrug thereof. These compounds are useful for treating a variety of hormone-related conditions including contraception, treating or preventing fibroids, endometriosis, dysfunctional bleeding, uterine leiomyomata, polycystic ovary syndrome, or hormone-dependent carcinomas, providing hormone replacement therapy, stimulating food intake or synchronizing estrus.
