15219-97-3 Usage
Description
Oxalysine, also known as L-2-amino-3-(2-aminoethoxy)propionic acid, is an L-alpha-amino acid derived from L-serine. It is an antimetabolic antibiotic obtained from Streptomyces reseoviri ofuscus. Oxalysine possesses unique structural properties, making it a potential candidate for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
Oxalysine is used as an antimetabolic antibiotic for its ability to inhibit certain metabolic pathways in bacteria, making it a valuable compound in the development of new antibiotics to combat drug-resistant infections.
Used in Research and Development:
Oxalysine is utilized as a research tool in the study of various biological processes and the development of novel therapeutic strategies. Its unique structure allows for the exploration of its potential interactions with other biomolecules and its role in cellular functions.
Used in Drug Design:
Due to its antimetabolic properties, Oxalysine can be employed as a starting point for the design of new drugs targeting specific metabolic pathways. This can lead to the development of more effective and targeted treatments for various diseases.
Safety Profile
Moderately toxic by ingestion, intraperitoneal, intravenous, and intramuscular routes. When heated to decomposition it emits toxic fumes of NOx.
Check Digit Verification of cas no
The CAS Registry Mumber 15219-97-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,2,1 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15219-97:
(7*1)+(6*5)+(5*2)+(4*1)+(3*9)+(2*9)+(1*7)=103
103 % 10 = 3
So 15219-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N2O3/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)
