15254-27-0 Usage
General Description
2-(3-chloro-4-toluoyl)benzoic acid is a chemical compound with the molecular formula C15H11ClO3. It is a derivative of benzoic acid with a chlorine atom and a methyl group attached to the benzene ring. 2-(3-chloro-4-toluoyl)benzoic acid is used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It has potential applications in the field of medicine and organic synthesis due to its unique chemical properties. 2-(3-chloro-4-toluoyl)benzoic acid may also have other industrial uses, but its specific applications would depend on its physical and chemical properties. Overall, 2-(3-chloro-4-toluoyl)benzoic acid is a versatile and potentially valuable chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 15254-27-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,2,5 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15254-27:
(7*1)+(6*5)+(5*2)+(4*5)+(3*4)+(2*2)+(1*7)=90
90 % 10 = 0
So 15254-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClO3/c1-9-6-7-10(8-13(9)16)14(17)11-4-2-3-5-12(11)15(18)19/h2-8H,1H3,(H,18,19)
